C25H30N4O3 — CID 69252998
[3-[4-[4-(2,3-dihydro-1-benzofuran-5-yl)piperazin-1-yl]butyl]-1-benzofuran-2-yl]urea (PubChem CID 69252998) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is [3-[4-[4-(2,3-dihydro-1-benzofuran-5-yl)piperazin-1-yl]butyl]-1-benzofuran-2-yl]urea.
| Compound Name | [3-[4-[4-(2,3-dihydro-1-benzofuran-5-yl)piperazin-1-yl]butyl]-1-benzofuran-2-yl]urea |
|---|---|
| PubChem CID | 69252998 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [3-[4-[4-(2,3-dihydro-1-benzofuran-5-yl)piperazin-1-yl]butyl]-1-benzofuran-2-yl]urea |
| SMILES | NC(=O)Nc1oc2ccccc2c1CCCCN1CCN(c2ccc3c(c2)CCO3)CC1 |
| InChI | InChI=1S/C25H30N4O3/c26-25(30)27-24-21(20-5-1-2-7-23(20)32-24)6-3-4-11-28-12-14-29(15-13-28)19-8-9-22-18(17-19)10-16-31-22/h1-2,5,7-9,17H,3-4,6,10-16H2,(H3,26,27,30) |
| InChIKey | XBKHSVSNLVKTDZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 83.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|