C23H28N2O5 — CID 18399632
1-(3,4-dihydro-2H-chromen-6-yl)-4-[(4-methylphenyl)methyl]piperazine;oxalic acid (PubChem CID 18399632) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-6-yl)-4-[(4-methylphenyl)methyl]piperazine;oxalic acid.
| Compound Name | 1-(3,4-dihydro-2H-chromen-6-yl)-4-[(4-methylphenyl)methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 18399632 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-6-yl)-4-[(4-methylphenyl)methyl]piperazine;oxalic acid |
| SMILES | Cc1ccc(CN2CCN(c3ccc4c(c3)CCCO4)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H26N2O.C2H2O4/c1-17-4-6-18(7-5-17)16-22-10-12-23(13-11-22)20-8-9-21-19(15-20)3-2-14-24-21;3-1(4)2(5)6/h4-9,15H,2-3,10-14,16H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | ZOWLEMRPIKRRGJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|