1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid

C16H24N2O4 — CID 163327143

IUPAC1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid
SMILESCc1ccc(CN2CCCN(C)CC2)cc1.O=C(O)C(=O)O
InChIInChI=1S/C14H22N2.C2H2O4/c1-13-4-6-14(7-5-13)12-16-9-3-8-15(2)10-11-16;3-1(4)2(5)6/h4-7H,3,8-12H2,1-2H3;(H,3,4)(H,5,6)
InChIKeyOLGXTIXONHQILB-UHFFFAOYSA-N
MW308.38 g/mol
LogP1.29
Rot. Bonds2

About 1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid

1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid (PubChem CID 163327143) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid.

Molecular Properties

Compound Name1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid
PubChem CID163327143
Molecular FormulaC16H24N2O4
Molecular Weight308.38 g/mol
Exact Mass308.17
IUPAC Name1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid
SMILESCc1ccc(CN2CCCN(C)CC2)cc1.O=C(O)C(=O)O
InChIInChI=1S/C14H22N2.C2H2O4/c1-13-4-6-14(7-5-13)12-16-9-3-8-15(2)10-11-16;3-1(4)2(5)6/h4-7H,3,8-12H2,1-2H3;(H,3,4)(H,5,6)
InChIKeyOLGXTIXONHQILB-UHFFFAOYSA-N
XLogP1.29
TPSA81.08 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.38
LogP ≤ 51.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid?
The IUPAC name of 1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid (CID 163327143) is 1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid.
What is the SMILES notation for 1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid?
The canonical SMILES for 1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid is Cc1ccc(CN2CCCN(C)CC2)cc1.O=C(O)C(=O)O.
What is the InChIKey of 1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid?
The InChIKey is OLGXTIXONHQILB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2.C2H2O4/c1-13-4-6-14(7-5-13)12-16-9-3-8-15(2)10-11-16;3-1(4)2(5)6/h4-7H,3,8-12H2,1-2H3;(H,3,4)(H,5,6).
What are the key properties of 1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid?
1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid has a molecular weight of 308.38 g/mol, XLogP of 1.29, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepane;oxalic acid is sourced from PubChem (CID 163327143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).