C21H27N3O — CID 142718219
2-methyl-5-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]benzamide (PubChem CID 142718219) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-methyl-5-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]benzamide.
| Compound Name | 2-methyl-5-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 142718219 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 2-methyl-5-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]benzamide |
| SMILES | Cc1ccc(-c2ccc(CN3CCCN(C)CC3)cc2)cc1C(N)=O |
| InChI | InChI=1S/C21H27N3O/c1-16-4-7-19(14-20(16)21(22)25)18-8-5-17(6-9-18)15-24-11-3-10-23(2)12-13-24/h4-9,14H,3,10-13,15H2,1-2H3,(H2,22,25) |
| InChIKey | FNGFRMZLSMDTFU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |