C20H22F2N2O — CID 86300761
2,6-difluoro-4-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]benzaldehyde (PubChem CID 86300761) has the molecular formula C20H22F2N2O and a molecular weight of 344.41 g/mol. Its IUPAC name is 2,6-difluoro-4-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]benzaldehyde.
| Compound Name | 2,6-difluoro-4-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]benzaldehyde |
|---|---|
| PubChem CID | 86300761 |
| Molecular Formula | C20H22F2N2O |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 2,6-difluoro-4-[4-[(4-methyl-1,4-diazepan-1-yl)methyl]phenyl]benzaldehyde |
| SMILES | CN1CCCN(Cc2ccc(-c3cc(F)c(C=O)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C20H22F2N2O/c1-23-7-2-8-24(10-9-23)13-15-3-5-16(6-4-15)17-11-19(21)18(14-25)20(22)12-17/h3-6,11-12,14H,2,7-10,13H2,1H3 |
| InChIKey | LKNNBRIAXBXVPV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|