C12H18ClN3O — CID 86599629
1-[(6-chloro-1-oxidopyridin-1-ium-3-yl)methyl]-4-methyl-1,4-diazepane (PubChem CID 86599629) has the molecular formula C12H18ClN3O and a molecular weight of 255.75 g/mol. Its IUPAC name is 1-[(6-chloro-1-oxidopyridin-1-ium-3-yl)methyl]-4-methyl-1,4-diazepane.
| Compound Name | 1-[(6-chloro-1-oxidopyridin-1-ium-3-yl)methyl]-4-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 86599629 |
| Molecular Formula | C12H18ClN3O |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-[(6-chloro-1-oxidopyridin-1-ium-3-yl)methyl]-4-methyl-1,4-diazepane |
| SMILES | CN1CCCN(Cc2ccc(Cl)[n+]([O-])c2)CC1 |
| InChI | InChI=1S/C12H18ClN3O/c1-14-5-2-6-15(8-7-14)9-11-3-4-12(13)16(17)10-11/h3-4,10H,2,5-9H2,1H3 |
| InChIKey | ZFTFICPSCQMETJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|