C15H22N2 — CID 166880014
1-[(4-ethenylphenyl)methyl]-4-methyl-1,4-diazepane (PubChem CID 166880014) has the molecular formula C15H22N2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 1-[(4-ethenylphenyl)methyl]-4-methyl-1,4-diazepane.
| Compound Name | 1-[(4-ethenylphenyl)methyl]-4-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 166880014 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-[(4-ethenylphenyl)methyl]-4-methyl-1,4-diazepane |
| SMILES | C=Cc1ccc(CN2CCCN(C)CC2)cc1 |
| InChI | InChI=1S/C15H22N2/c1-3-14-5-7-15(8-6-14)13-17-10-4-9-16(2)11-12-17/h3,5-8H,1,4,9-13H2,2H3 |
| InChIKey | UEIRQFAJZNBSAV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |