C19H28N3+ — CID 10592792
5-[(4-ethenylphenyl)methyl]-5,9-diaza-1-azoniabicyclo[7.3.1]tridec-1(13)-ene (PubChem CID 10592792) has the molecular formula C19H28N3+ and a molecular weight of 298.45 g/mol. Its IUPAC name is 5-[(4-ethenylphenyl)methyl]-5,9-diaza-1-azoniabicyclo[7.3.1]tridec-1(13)-ene.
| Compound Name | 5-[(4-ethenylphenyl)methyl]-5,9-diaza-1-azoniabicyclo[7.3.1]tridec-1(13)-ene |
|---|---|
| PubChem CID | 10592792 |
| Molecular Formula | C19H28N3+ |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 5-[(4-ethenylphenyl)methyl]-5,9-diaza-1-azoniabicyclo[7.3.1]tridec-1(13)-ene |
| SMILES | C=Cc1ccc(CN2CCCN3C=[N+](CCC3)CCC2)cc1 |
| InChI | InChI=1S/C19H28N3/c1-2-18-6-8-19(9-7-18)16-20-10-3-12-21-14-5-15-22(17-21)13-4-11-20/h2,6-9,17H,1,3-5,10-16H2/q+1 |
| InChIKey | TZFHZDCAOLGPBW-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|