C40H44N4O4 — CID 154202644
4-[[4,7,10-tris[(4-formylphenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]methyl]benzaldehyde (PubChem CID 154202644) has the molecular formula C40H44N4O4 and a molecular weight of 644.82 g/mol. Its IUPAC name is 4-[[4,7,10-tris[(4-formylphenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]methyl]benzaldehyde.
| Compound Name | 4-[[4,7,10-tris[(4-formylphenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]methyl]benzaldehyde |
|---|---|
| PubChem CID | 154202644 |
| Molecular Formula | C40H44N4O4 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.34 |
| IUPAC Name | 4-[[4,7,10-tris[(4-formylphenyl)methyl]-1,4,7,10-tetrazacyclododec-1-yl]methyl]benzaldehyde |
| SMILES | O=Cc1ccc(CN2CCN(Cc3ccc(C=O)cc3)CCN(Cc3ccc(C=O)cc3)CCN(Cc3ccc(C=O)cc3)CC2)cc1 |
| InChI | InChI=1S/C40H44N4O4/c45-29-37-9-1-33(2-10-37)25-41-17-19-42(26-34-3-11-38(30-46)12-4-34)21-23-44(28-36-7-15-40(32-48)16-8-36)24-22-43(20-18-41)27-35-5-13-39(31-47)14-6-35/h1-16,29-32H,17-28H2 |
| InChIKey | XDPRJPPATIGRHF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|