C13H20FN3 — CID 63188505
2-fluoro-4-[(4-methyl-1,4-diazepan-1-yl)methyl]aniline (PubChem CID 63188505) has the molecular formula C13H20FN3 and a molecular weight of 237.32 g/mol. Its IUPAC name is 2-fluoro-4-[(4-methyl-1,4-diazepan-1-yl)methyl]aniline.
| Compound Name | 2-fluoro-4-[(4-methyl-1,4-diazepan-1-yl)methyl]aniline |
|---|---|
| PubChem CID | 63188505 |
| Molecular Formula | C13H20FN3 |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 2-fluoro-4-[(4-methyl-1,4-diazepan-1-yl)methyl]aniline |
| SMILES | CN1CCCN(Cc2ccc(N)c(F)c2)CC1 |
| InChI | InChI=1S/C13H20FN3/c1-16-5-2-6-17(8-7-16)10-11-3-4-13(15)12(14)9-11/h3-4,9H,2,5-8,10,15H2,1H3 |
| InChIKey | PPSQQXDQAYRXEZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|