C11H15FN2O2 — CID 106667782
1-[(4-amino-3-fluorophenyl)methyl]pyrrolidine-3,4-diol (PubChem CID 106667782) has the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. Its IUPAC name is 1-[(4-amino-3-fluorophenyl)methyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[(4-amino-3-fluorophenyl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106667782 |
| Molecular Formula | C11H15FN2O2 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1-[(4-amino-3-fluorophenyl)methyl]pyrrolidine-3,4-diol |
| SMILES | Nc1ccc(CN2CC(O)C(O)C2)cc1F |
| InChI | InChI=1S/C11H15FN2O2/c12-8-3-7(1-2-9(8)13)4-14-5-10(15)11(16)6-14/h1-3,10-11,15-16H,4-6,13H2 |
| InChIKey | QUEBHYBOWMJANN-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|