C12H16FNO3 — CID 106672792
1-[(3-fluoro-4-methoxyphenyl)methyl]pyrrolidine-3,4-diol (PubChem CID 106672792) has the molecular formula C12H16FNO3 and a molecular weight of 241.26 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methoxyphenyl)methyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[(3-fluoro-4-methoxyphenyl)methyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106672792 |
| Molecular Formula | C12H16FNO3 |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 1-[(3-fluoro-4-methoxyphenyl)methyl]pyrrolidine-3,4-diol |
| SMILES | COc1ccc(CN2CC(O)C(O)C2)cc1F |
| InChI | InChI=1S/C12H16FNO3/c1-17-12-3-2-8(4-9(12)13)5-14-6-10(15)11(16)7-14/h2-4,10-11,15-16H,5-7H2,1H3 |
| InChIKey | YBKHBVXMOBPOAE-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |