C18H27FN2O2 — CID 70765614
1-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]piperidin-4-ol (PubChem CID 70765614) has the molecular formula C18H27FN2O2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 1-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]piperidin-4-ol.
| Compound Name | 1-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]piperidin-4-ol |
|---|---|
| PubChem CID | 70765614 |
| Molecular Formula | C18H27FN2O2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 1-[1-[(3-fluoro-4-methoxyphenyl)methyl]piperidin-4-yl]piperidin-4-ol |
| SMILES | COc1ccc(CN2CCC(N3CCC(O)CC3)CC2)cc1F |
| InChI | InChI=1S/C18H27FN2O2/c1-23-18-3-2-14(12-17(18)19)13-20-8-4-15(5-9-20)21-10-6-16(22)7-11-21/h2-3,12,15-16,22H,4-11,13H2,1H3 |
| InChIKey | NPQZWSAACMKJJY-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |