C25H31N5O3 — CID 69252666
[1-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]butyl]indol-2-yl]urea (PubChem CID 69252666) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is [1-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]butyl]indol-2-yl]urea.
| Compound Name | [1-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]butyl]indol-2-yl]urea |
|---|---|
| PubChem CID | 69252666 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | [1-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazin-1-yl]butyl]indol-2-yl]urea |
| SMILES | NC(=O)Nc1cc2ccccc2n1CCCCN1CCN(c2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C25H31N5O3/c26-25(31)27-24-17-19-5-1-2-6-21(19)30(24)10-4-3-9-28-11-13-29(14-12-28)20-7-8-22-23(18-20)33-16-15-32-22/h1-2,5-8,17-18H,3-4,9-16H2,(H3,26,27,31) |
| InChIKey | XFVDHFWKEBLDNH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|