C26H32N4O3S — CID 69252388
1-(1-benzothiophen-3-yl)-1-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-diazepan-1-yl]butyl]urea (PubChem CID 69252388) has the molecular formula C26H32N4O3S and a molecular weight of 480.63 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-1-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-diazepan-1-yl]butyl]urea.
| Compound Name | 1-(1-benzothiophen-3-yl)-1-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-diazepan-1-yl]butyl]urea |
|---|---|
| PubChem CID | 69252388 |
| Molecular Formula | C26H32N4O3S |
| Molecular Weight | 480.63 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-1-[4-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-diazepan-1-yl]butyl]urea |
| SMILES | NC(=O)N(CCCCN1CCCN(c2ccc3c(c2)OCCO3)CC1)c1csc2ccccc12 |
| InChI | InChI=1S/C26H32N4O3S/c27-26(31)30(22-19-34-25-7-2-1-6-21(22)25)13-4-3-10-28-11-5-12-29(15-14-28)20-8-9-23-24(18-20)33-17-16-32-23/h1-2,6-9,18-19H,3-5,10-17H2,(H2,27,31) |
| InChIKey | IJHUVVLWELJGKB-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 71.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.63 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|