C27H34N4O2S — CID 11662973
1-(1-benzothiophen-2-yl)-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)-1,4-diazepan-1-yl]butyl]urea (PubChem CID 11662973) has the molecular formula C27H34N4O2S and a molecular weight of 478.66 g/mol. Its IUPAC name is 1-(1-benzothiophen-2-yl)-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)-1,4-diazepan-1-yl]butyl]urea.
| Compound Name | 1-(1-benzothiophen-2-yl)-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)-1,4-diazepan-1-yl]butyl]urea |
|---|---|
| PubChem CID | 11662973 |
| Molecular Formula | C27H34N4O2S |
| Molecular Weight | 478.66 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 1-(1-benzothiophen-2-yl)-1-[4-[4-(3,4-dihydro-2H-chromen-8-yl)-1,4-diazepan-1-yl]butyl]urea |
| SMILES | NC(=O)N(CCCCN1CCCN(c2cccc3c2OCCC3)CC1)c1cc2ccccc2s1 |
| InChI | InChI=1S/C27H34N4O2S/c28-27(32)31(25-20-22-8-1-2-12-24(22)34-25)16-4-3-13-29-14-7-15-30(18-17-29)23-11-5-9-21-10-6-19-33-26(21)23/h1-2,5,8-9,11-12,20H,3-4,6-7,10,13-19H2,(H2,28,32) |
| InChIKey | ZIAJJGIVZNCJTI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 62.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.66 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|