C24H30N4O5 — CID 42390316
N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]oxamide (PubChem CID 42390316) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]oxamide.
| Compound Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]oxamide |
|---|---|
| PubChem CID | 42390316 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]oxamide |
| SMILES | COc1ccc(N2CCN(CCCNC(=O)C(=O)Nc3ccc4c(c3)OCCO4)CC2)cc1 |
| InChI | InChI=1S/C24H30N4O5/c1-31-20-6-4-19(5-7-20)28-13-11-27(12-14-28)10-2-9-25-23(29)24(30)26-18-3-8-21-22(17-18)33-16-15-32-21/h3-8,17H,2,9-16H2,1H3,(H,25,29)(H,26,30) |
| InChIKey | ZCPBGVBHVAYYPA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|