C26H29N3O4 — CID 19794342
3-(4-naphthalen-1-ylpiperazin-1-yl)propyl N-(2,3-dihydro-1,4-benzodioxin-6-yl)carbamate (PubChem CID 19794342) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 3-(4-naphthalen-1-ylpiperazin-1-yl)propyl N-(2,3-dihydro-1,4-benzodioxin-6-yl)carbamate.
| Compound Name | 3-(4-naphthalen-1-ylpiperazin-1-yl)propyl N-(2,3-dihydro-1,4-benzodioxin-6-yl)carbamate |
|---|---|
| PubChem CID | 19794342 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 3-(4-naphthalen-1-ylpiperazin-1-yl)propyl N-(2,3-dihydro-1,4-benzodioxin-6-yl)carbamate |
| SMILES | O=C(Nc1ccc2c(c1)OCCO2)OCCCN1CCN(c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C26H29N3O4/c30-26(27-21-9-10-24-25(19-21)32-18-17-31-24)33-16-4-11-28-12-14-29(15-13-28)23-8-3-6-20-5-1-2-7-22(20)23/h1-3,5-10,19H,4,11-18H2,(H,27,30) |
| InChIKey | PEKPQZBNXRYXMP-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|