C23H31ClIN5O2 — CID 111082434
2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide (PubChem CID 111082434) has the molecular formula C23H31ClIN5O2 and a molecular weight of 571.89 g/mol. Its IUPAC name is 2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide.
| Compound Name | 2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111082434 |
| Molecular Formula | C23H31ClIN5O2 |
| Molecular Weight | 571.89 g/mol |
| Exact Mass | 571.12 |
| IUPAC Name | 2-[3-[4-(2-chlorophenyl)piperazin-1-yl]propyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCCN1CCN(c2ccccc2Cl)CC1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C23H30ClN5O2.HI/c24-19-5-1-2-6-20(19)29-13-11-28(12-14-29)10-3-9-26-23(25)27-18-7-8-21-22(17-18)31-16-4-15-30-21;/h1-2,5-8,17H,3-4,9-16H2,(H3,25,26,27);1H |
| InChIKey | LBCSUYJYYOZLRC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.89 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|