C25H35N5O2 — CID 111066829
2-[4-(4-benzylpiperazin-1-yl)butyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine (PubChem CID 111066829) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 2-[4-(4-benzylpiperazin-1-yl)butyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine.
| Compound Name | 2-[4-(4-benzylpiperazin-1-yl)butyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine |
|---|---|
| PubChem CID | 111066829 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 2-[4-(4-benzylpiperazin-1-yl)butyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine |
| SMILES | N/C(=N\CCCCN1CCN(Cc2ccccc2)CC1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C25H35N5O2/c26-25(28-22-9-10-23-24(19-22)32-18-6-17-31-23)27-11-4-5-12-29-13-15-30(16-14-29)20-21-7-2-1-3-8-21/h1-3,7-10,19H,4-6,11-18,20H2,(H3,26,27,28) |
| InChIKey | PQVMOUOAZKIVSN-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|