C24H32N4O2 — CID 111802668
2-[[2-(azepan-1-ylmethyl)phenyl]methyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine (PubChem CID 111802668) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-[[2-(azepan-1-ylmethyl)phenyl]methyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine.
| Compound Name | 2-[[2-(azepan-1-ylmethyl)phenyl]methyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine |
|---|---|
| PubChem CID | 111802668 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 2-[[2-(azepan-1-ylmethyl)phenyl]methyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine |
| SMILES | N/C(=N\Cc1ccccc1CN1CCCCCC1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C24H32N4O2/c25-24(27-21-10-11-22-23(16-21)30-15-7-14-29-22)26-17-19-8-3-4-9-20(19)18-28-12-5-1-2-6-13-28/h3-4,8-11,16H,1-2,5-7,12-15,17-18H2,(H3,25,26,27) |
| InChIKey | KNGQZELQEYGUSE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|