C23H32ClN5O — CID 111066825
2-[4-(4-benzylpiperazin-1-yl)butyl]-1-(3-chloro-4-methoxyphenyl)guanidine (PubChem CID 111066825) has the molecular formula C23H32ClN5O and a molecular weight of 430.00 g/mol. Its IUPAC name is 2-[4-(4-benzylpiperazin-1-yl)butyl]-1-(3-chloro-4-methoxyphenyl)guanidine.
| Compound Name | 2-[4-(4-benzylpiperazin-1-yl)butyl]-1-(3-chloro-4-methoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111066825 |
| Molecular Formula | C23H32ClN5O |
| Molecular Weight | 430.00 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 2-[4-(4-benzylpiperazin-1-yl)butyl]-1-(3-chloro-4-methoxyphenyl)guanidine |
| SMILES | COc1ccc(N/C(N)=N/CCCCN2CCN(Cc3ccccc3)CC2)cc1Cl |
| InChI | InChI=1S/C23H32ClN5O/c1-30-22-10-9-20(17-21(22)24)27-23(25)26-11-5-6-12-28-13-15-29(16-14-28)18-19-7-3-2-4-8-19/h2-4,7-10,17H,5-6,11-16,18H2,1H3,(H3,25,26,27) |
| InChIKey | UAMVEJFNUMHVRZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.00 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|