C18H24ClN7O — CID 111062155
1-(3-chloro-4-methoxyphenyl)-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine (PubChem CID 111062155) has the molecular formula C18H24ClN7O and a molecular weight of 389.89 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111062155 |
| Molecular Formula | C18H24ClN7O |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CCN2CCN(c3ncccn3)CC2)cc1Cl |
| InChI | InChI=1S/C18H24ClN7O/c1-27-16-4-3-14(13-15(16)19)24-17(20)21-7-8-25-9-11-26(12-10-25)18-22-5-2-6-23-18/h2-6,13H,7-12H2,1H3,(H3,20,21,24) |
| InChIKey | ZZKRDNXQABWJMF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|