C20H27ClN6O — CID 111087003
1-(3-chloro-4-methoxyphenyl)-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine (PubChem CID 111087003) has the molecular formula C20H27ClN6O and a molecular weight of 402.93 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 111087003 |
| Molecular Formula | C20H27ClN6O |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[[2-(4-ethylpiperazin-1-yl)-4-pyridinyl]methyl]guanidine |
| SMILES | CCN1CCN(c2cc(C/N=C(\N)Nc3ccc(OC)c(Cl)c3)ccn2)CC1 |
| InChI | InChI=1S/C20H27ClN6O/c1-3-26-8-10-27(11-9-26)19-12-15(6-7-23-19)14-24-20(22)25-16-4-5-18(28-2)17(21)13-16/h4-7,12-13H,3,8-11,14H2,1-2H3,(H3,22,24,25) |
| InChIKey | VZGDQUDECJOCSH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|