C20H26ClIN6O2 — CID 111092217
1-(3-chloro-4-methoxyphenyl)-2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111092217) has the molecular formula C20H26ClIN6O2 and a molecular weight of 544.83 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111092217 |
| Molecular Formula | C20H26ClIN6O2 |
| Molecular Weight | 544.83 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/CCC(=O)N2CCN(c3ccccn3)CC2)cc1Cl.I |
| InChI | InChI=1S/C20H25ClN6O2.HI/c1-29-17-6-5-15(14-16(17)21)25-20(22)24-9-7-19(28)27-12-10-26(11-13-27)18-4-2-3-8-23-18;/h2-6,8,14H,7,9-13H2,1H3,(H3,22,24,25);1H |
| InChIKey | KRGAFIJFALNJCN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 96.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.83 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|