C20H26N6O2 — CID 111092164
1-(3-methoxyphenyl)-2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine (PubChem CID 111092164) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-(3-methoxyphenyl)-2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111092164 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-(3-methoxyphenyl)-2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]guanidine |
| SMILES | COc1cccc(N/C(N)=N/CCC(=O)N2CCN(c3ccccn3)CC2)c1 |
| InChI | InChI=1S/C20H26N6O2/c1-28-17-6-4-5-16(15-17)24-20(21)23-10-8-19(27)26-13-11-25(12-14-26)18-7-2-3-9-22-18/h2-7,9,15H,8,10-14H2,1H3,(H3,21,23,24) |
| InChIKey | CUAOKTFHCVJPKE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 96.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|