C20H23F3N6O2 — CID 111092202
2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1-[4-(trifluoromethoxy)phenyl]guanidine (PubChem CID 111092202) has the molecular formula C20H23F3N6O2 and a molecular weight of 436.44 g/mol. Its IUPAC name is 2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1-[4-(trifluoromethoxy)phenyl]guanidine.
| Compound Name | 2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
|---|---|
| PubChem CID | 111092202 |
| Molecular Formula | C20H23F3N6O2 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-[3-oxo-3-(4-pyridin-2-ylpiperazin-1-yl)propyl]-1-[4-(trifluoromethoxy)phenyl]guanidine |
| SMILES | N/C(=N\CCC(=O)N1CCN(c2ccccn2)CC1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H23F3N6O2/c21-20(22,23)31-16-6-4-15(5-7-16)27-19(24)26-10-8-18(30)29-13-11-28(12-14-29)17-3-1-2-9-25-17/h1-7,9H,8,10-14H2,(H3,24,26,27) |
| InChIKey | ILUSSQZFHUNGQM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 96.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|