C19H26IN7O — CID 111095879
1-(4-methylphenyl)-2-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111095879) has the molecular formula C19H26IN7O and a molecular weight of 495.37 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(4-methylphenyl)-2-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111095879 |
| Molecular Formula | C19H26IN7O |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | 1-(4-methylphenyl)-2-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | Cc1ccc(N/C(N)=N/CCC(=O)N2CCN(c3ncccn3)CC2)cc1.I |
| InChI | InChI=1S/C19H25N7O.HI/c1-15-3-5-16(6-4-15)24-18(20)21-10-7-17(27)25-11-13-26(14-12-25)19-22-8-2-9-23-19;/h2-6,8-9H,7,10-14H2,1H3,(H3,20,21,24);1H |
| InChIKey | RPIUICBRGMQIER-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|