C22H29N5O — CID 111092098
1-(3,5-dimethylphenyl)-2-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]guanidine (PubChem CID 111092098) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111092098 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]guanidine |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CCC(=O)N2CCN(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C22H29N5O/c1-17-14-18(2)16-19(15-17)25-22(23)24-9-8-21(28)27-12-10-26(11-13-27)20-6-4-3-5-7-20/h3-7,14-16H,8-13H2,1-2H3,(H3,23,24,25) |
| InChIKey | GXWDGOUWNMPEGP-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|