C20H33N5O — CID 111092108
2-hexyl-1-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]guanidine (PubChem CID 111092108) has the molecular formula C20H33N5O and a molecular weight of 359.52 g/mol. Its IUPAC name is 2-hexyl-1-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]guanidine.
| Compound Name | 2-hexyl-1-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111092108 |
| Molecular Formula | C20H33N5O |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.27 |
| IUPAC Name | 2-hexyl-1-[3-oxo-3-(4-phenylpiperazin-1-yl)propyl]guanidine |
| SMILES | CCCCCC/N=C(\N)NCCC(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H33N5O/c1-2-3-4-8-12-22-20(21)23-13-11-19(26)25-16-14-24(15-17-25)18-9-6-5-7-10-18/h5-7,9-10H,2-4,8,11-17H2,1H3,(H3,21,22,23) |
| InChIKey | UNQMMCXRFIIFHP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|