C16H26IN5O — CID 111088896
2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1-propylguanidine;hydroiodide (PubChem CID 111088896) has the molecular formula C16H26IN5O and a molecular weight of 431.32 g/mol. Its IUPAC name is 2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1-propylguanidine;hydroiodide.
| Compound Name | 2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111088896 |
| Molecular Formula | C16H26IN5O |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-1-propylguanidine;hydroiodide |
| SMILES | CCCN/C(N)=N/CC(=O)N1CCN(c2ccccc2)CC1.I |
| InChI | InChI=1S/C16H25N5O.HI/c1-2-8-18-16(17)19-13-15(22)21-11-9-20(10-12-21)14-6-4-3-5-7-14;/h3-7H,2,8-13H2,1H3,(H3,17,18,19);1H |
| InChIKey | TTYMCVFUMXKPQV-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|