C18H24IN7O — CID 110927943
2-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1-phenylguanidine;hydroiodide (PubChem CID 110927943) has the molecular formula C18H24IN7O and a molecular weight of 481.34 g/mol. Its IUPAC name is 2-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1-phenylguanidine;hydroiodide.
| Compound Name | 2-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1-phenylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110927943 |
| Molecular Formula | C18H24IN7O |
| Molecular Weight | 481.34 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | 2-[3-oxo-3-(4-pyrimidin-2-ylpiperazin-1-yl)propyl]-1-phenylguanidine;hydroiodide |
| SMILES | I.N/C(=N\CCC(=O)N1CCN(c2ncccn2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C18H23N7O.HI/c19-17(23-15-5-2-1-3-6-15)20-10-7-16(26)24-11-13-25(14-12-24)18-21-8-4-9-22-18;/h1-6,8-9H,7,10-14H2,(H3,19,20,23);1H |
| InChIKey | UNFCAAXKKRZSJP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|