C21H26N4O — CID 111810778
2-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-1-(3,5-dimethylphenyl)guanidine (PubChem CID 111810778) has the molecular formula C21H26N4O and a molecular weight of 350.47 g/mol. Its IUPAC name is 2-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-1-(3,5-dimethylphenyl)guanidine.
| Compound Name | 2-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-1-(3,5-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 111810778 |
| Molecular Formula | C21H26N4O |
| Molecular Weight | 350.47 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 2-[4-(1,3-dihydroisoindol-2-yl)-4-oxobutyl]-1-(3,5-dimethylphenyl)guanidine |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CCCC(=O)N2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C21H26N4O/c1-15-10-16(2)12-19(11-15)24-21(22)23-9-5-8-20(26)25-13-17-6-3-4-7-18(17)14-25/h3-4,6-7,10-12H,5,8-9,13-14H2,1-2H3,(H3,22,23,24) |
| InChIKey | QQPMXCZLHLXGBT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|