C18H22N4O2 — CID 86989093
1-(3-methoxyphenyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea (PubChem CID 86989093) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-(3-methoxyphenyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 86989093 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
| SMILES | COc1cccc(NC(=O)NC2CCN(c3ccccn3)CC2)c1 |
| InChI | InChI=1S/C18H22N4O2/c1-24-16-6-4-5-15(13-16)21-18(23)20-14-8-11-22(12-9-14)17-7-2-3-10-19-17/h2-7,10,13-14H,8-9,11-12H2,1H3,(H2,20,21,23) |
| InChIKey | VEOXIIBNFZPSQG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |