C23H24N4O2 — CID 87007480
1-(3-phenoxyphenyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea (PubChem CID 87007480) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 1-(3-phenoxyphenyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-(3-phenoxyphenyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 87007480 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 1-(3-phenoxyphenyl)-3-(1-pyridin-2-ylpiperidin-4-yl)urea |
| SMILES | O=C(Nc1cccc(Oc2ccccc2)c1)NC1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C23H24N4O2/c28-23(25-18-12-15-27(16-13-18)22-11-4-5-14-24-22)26-19-7-6-10-21(17-19)29-20-8-2-1-3-9-20/h1-11,14,17-18H,12-13,15-16H2,(H2,25,26,28) |
| InChIKey | BBQXCGLWUGIBKO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |