C18H19N7O — CID 124568770
1-[(3S)-1-pyridin-2-ylpyrrolidin-3-yl]-3-[3-(triazol-1-yl)phenyl]urea (PubChem CID 124568770) has the molecular formula C18H19N7O and a molecular weight of 349.40 g/mol. Its IUPAC name is 1-[(3S)-1-pyridin-2-ylpyrrolidin-3-yl]-3-[3-(triazol-1-yl)phenyl]urea.
| Compound Name | 1-[(3S)-1-pyridin-2-ylpyrrolidin-3-yl]-3-[3-(triazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 124568770 |
| Molecular Formula | C18H19N7O |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 1-[(3S)-1-pyridin-2-ylpyrrolidin-3-yl]-3-[3-(triazol-1-yl)phenyl]urea |
| SMILES | O=C(Nc1cccc(-n2ccnn2)c1)N[C@H]1CCN(c2ccccn2)C1 |
| InChI | InChI=1S/C18H19N7O/c26-18(21-14-4-3-5-16(12-14)25-11-9-20-23-25)22-15-7-10-24(13-15)17-6-1-2-8-19-17/h1-6,8-9,11-12,15H,7,10,13H2,(H2,21,22,26)/t15-/m0/s1 |
| InChIKey | KSXXFPQOUPRGPD-HNNXBMFYSA-N |
| XLogP | 2.06 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |