C16H19N5O2 — CID 75433407
1-(5-methyl-6-oxo-1H-pyridin-3-yl)-3-(1-pyridin-2-ylpyrrolidin-3-yl)urea (PubChem CID 75433407) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-(5-methyl-6-oxo-1H-pyridin-3-yl)-3-(1-pyridin-2-ylpyrrolidin-3-yl)urea.
| Compound Name | 1-(5-methyl-6-oxo-1H-pyridin-3-yl)-3-(1-pyridin-2-ylpyrrolidin-3-yl)urea |
|---|---|
| PubChem CID | 75433407 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-(5-methyl-6-oxo-1H-pyridin-3-yl)-3-(1-pyridin-2-ylpyrrolidin-3-yl)urea |
| SMILES | Cc1cc(NC(=O)NC2CCN(c3ccccn3)C2)c[nH]c1=O |
| InChI | InChI=1S/C16H19N5O2/c1-11-8-13(9-18-15(11)22)20-16(23)19-12-5-7-21(10-12)14-4-2-3-6-17-14/h2-4,6,8-9,12H,5,7,10H2,1H3,(H,18,22)(H2,19,20,23) |
| InChIKey | DVYWJFBIVCQCBI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |