C19H25N5O — CID 97335866
1-[3-(dimethylamino)-2-methylphenyl]-3-[(3R)-1-pyridin-2-ylpyrrolidin-3-yl]urea (PubChem CID 97335866) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is 1-[3-(dimethylamino)-2-methylphenyl]-3-[(3R)-1-pyridin-2-ylpyrrolidin-3-yl]urea.
| Compound Name | 1-[3-(dimethylamino)-2-methylphenyl]-3-[(3R)-1-pyridin-2-ylpyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 97335866 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 1-[3-(dimethylamino)-2-methylphenyl]-3-[(3R)-1-pyridin-2-ylpyrrolidin-3-yl]urea |
| SMILES | Cc1c(NC(=O)N[C@@H]2CCN(c3ccccn3)C2)cccc1N(C)C |
| InChI | InChI=1S/C19H25N5O/c1-14-16(7-6-8-17(14)23(2)3)22-19(25)21-15-10-12-24(13-15)18-9-4-5-11-20-18/h4-9,11,15H,10,12-13H2,1-3H3,(H2,21,22,25)/t15-/m1/s1 |
| InChIKey | QLKXFRDTVMOCBC-OAHLLOKOSA-N |
| XLogP | 2.86 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |