C17H25N3O3 — CID 122088906
4-[[3-(dimethylamino)-2-methylphenyl]carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122088906) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is 4-[[3-(dimethylamino)-2-methylphenyl]carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[3-(dimethylamino)-2-methylphenyl]carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122088906 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 4-[[3-(dimethylamino)-2-methylphenyl]carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | Cc1c(NC(=O)NC2CCC(C(=O)O)CC2)cccc1N(C)C |
| InChI | InChI=1S/C17H25N3O3/c1-11-14(5-4-6-15(11)20(2)3)19-17(23)18-13-9-7-12(8-10-13)16(21)22/h4-6,12-13H,7-10H2,1-3H3,(H,21,22)(H2,18,19,23) |
| InChIKey | FUJZUQPURYUJEI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |