C21H29N3O4 — CID 122077257
4-[[2-(4-methylpiperidine-1-carbonyl)phenyl]carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122077257) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-[[2-(4-methylpiperidine-1-carbonyl)phenyl]carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-(4-methylpiperidine-1-carbonyl)phenyl]carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122077257 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | 4-[[2-(4-methylpiperidine-1-carbonyl)phenyl]carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | CC1CCN(C(=O)c2ccccc2NC(=O)NC2CCC(C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C21H29N3O4/c1-14-10-12-24(13-11-14)19(25)17-4-2-3-5-18(17)23-21(28)22-16-8-6-15(7-9-16)20(26)27/h2-5,14-16H,6-13H2,1H3,(H,26,27)(H2,22,23,28) |
| InChIKey | DSRMDDRXEQRSCW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |