C19H28N4O2 — CID 4943688
1-cyclohexyl-3-[2-(4-methylpiperazine-1-carbonyl)phenyl]urea (PubChem CID 4943688) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(4-methylpiperazine-1-carbonyl)phenyl]urea.
| Compound Name | 1-cyclohexyl-3-[2-(4-methylpiperazine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 4943688 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 1-cyclohexyl-3-[2-(4-methylpiperazine-1-carbonyl)phenyl]urea |
| SMILES | CN1CCN(C(=O)c2ccccc2NC(=O)NC2CCCCC2)CC1 |
| InChI | InChI=1S/C19H28N4O2/c1-22-11-13-23(14-12-22)18(24)16-9-5-6-10-17(16)21-19(25)20-15-7-3-2-4-8-15/h5-6,9-10,15H,2-4,7-8,11-14H2,1H3,(H2,20,21,25) |
| InChIKey | AAUQHXZZSVAPDF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |