C22H27N3O3 — CID 122078232
4-[[2-[benzyl(methyl)amino]phenyl]carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122078232) has the molecular formula C22H27N3O3 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-[[2-[benzyl(methyl)amino]phenyl]carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-[benzyl(methyl)amino]phenyl]carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122078232 |
| Molecular Formula | C22H27N3O3 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 4-[[2-[benzyl(methyl)amino]phenyl]carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | CN(Cc1ccccc1)c1ccccc1NC(=O)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C22H27N3O3/c1-25(15-16-7-3-2-4-8-16)20-10-6-5-9-19(20)24-22(28)23-18-13-11-17(12-14-18)21(26)27/h2-10,17-18H,11-15H2,1H3,(H,26,27)(H2,23,24,28) |
| InChIKey | KXAUAJIZNZRIQM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |