C19H27Cl2N3O — CID 119864866
N-[2-[benzyl(methyl)amino]phenyl]-2-methyl-3-(methylamino)propanamide;dihydrochloride (PubChem CID 119864866) has the molecular formula C19H27Cl2N3O and a molecular weight of 384.35 g/mol. Its IUPAC name is N-[2-[benzyl(methyl)amino]phenyl]-2-methyl-3-(methylamino)propanamide;dihydrochloride.
| Compound Name | N-[2-[benzyl(methyl)amino]phenyl]-2-methyl-3-(methylamino)propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119864866 |
| Molecular Formula | C19H27Cl2N3O |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[2-[benzyl(methyl)amino]phenyl]-2-methyl-3-(methylamino)propanamide;dihydrochloride |
| SMILES | CNCC(C)C(=O)Nc1ccccc1N(C)Cc1ccccc1.Cl.Cl |
| InChI | InChI=1S/C19H25N3O.2ClH/c1-15(13-20-2)19(23)21-17-11-7-8-12-18(17)22(3)14-16-9-5-4-6-10-16;;/h4-12,15,20H,13-14H2,1-3H3,(H,21,23);2*1H |
| InChIKey | PDXXEPGSEQRSGO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |