C16H21FN2O4 — CID 122094575
4-[[2-(2-fluoroethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122094575) has the molecular formula C16H21FN2O4 and a molecular weight of 324.35 g/mol. Its IUPAC name is 4-[[2-(2-fluoroethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-(2-fluoroethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122094575 |
| Molecular Formula | C16H21FN2O4 |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 4-[[2-(2-fluoroethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(Nc1ccccc1OCCF)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C16H21FN2O4/c17-9-10-23-14-4-2-1-3-13(14)19-16(22)18-12-7-5-11(6-8-12)15(20)21/h1-4,11-12H,5-10H2,(H,20,21)(H2,18,19,22) |
| InChIKey | LNXDOKIMGKZWEZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |