C17H25F2N3O2 — CID 49111775
1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-(2-propoxyphenyl)urea (PubChem CID 49111775) has the molecular formula C17H25F2N3O2 and a molecular weight of 341.40 g/mol. Its IUPAC name is 1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-(2-propoxyphenyl)urea.
| Compound Name | 1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-(2-propoxyphenyl)urea |
|---|---|
| PubChem CID | 49111775 |
| Molecular Formula | C17H25F2N3O2 |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 1-[1-(2,2-difluoroethyl)piperidin-4-yl]-3-(2-propoxyphenyl)urea |
| SMILES | CCCOc1ccccc1NC(=O)NC1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C17H25F2N3O2/c1-2-11-24-15-6-4-3-5-14(15)21-17(23)20-13-7-9-22(10-8-13)12-16(18)19/h3-6,13,16H,2,7-12H2,1H3,(H2,20,21,23) |
| InChIKey | NGWZIMZQPIMJLR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |