C20H30FN3O3 — CID 55819670
1-(2-ethoxy-4-fluorophenyl)-3-[1-(2-ethylbutanoyl)piperidin-4-yl]urea (PubChem CID 55819670) has the molecular formula C20H30FN3O3 and a molecular weight of 379.48 g/mol. Its IUPAC name is 1-(2-ethoxy-4-fluorophenyl)-3-[1-(2-ethylbutanoyl)piperidin-4-yl]urea.
| Compound Name | 1-(2-ethoxy-4-fluorophenyl)-3-[1-(2-ethylbutanoyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 55819670 |
| Molecular Formula | C20H30FN3O3 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 1-(2-ethoxy-4-fluorophenyl)-3-[1-(2-ethylbutanoyl)piperidin-4-yl]urea |
| SMILES | CCOc1cc(F)ccc1NC(=O)NC1CCN(C(=O)C(CC)CC)CC1 |
| InChI | InChI=1S/C20H30FN3O3/c1-4-14(5-2)19(25)24-11-9-16(10-12-24)22-20(26)23-17-8-7-15(21)13-18(17)27-6-3/h7-8,13-14,16H,4-6,9-12H2,1-3H3,(H2,22,23,26) |
| InChIKey | XUXGIAHVYUVZKA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |