C19H22FN3O4 — CID 55793659
1-(2-ethoxy-4-fluorophenyl)-3-[1-(furan-3-carbonyl)piperidin-4-yl]urea (PubChem CID 55793659) has the molecular formula C19H22FN3O4 and a molecular weight of 375.40 g/mol. Its IUPAC name is 1-(2-ethoxy-4-fluorophenyl)-3-[1-(furan-3-carbonyl)piperidin-4-yl]urea.
| Compound Name | 1-(2-ethoxy-4-fluorophenyl)-3-[1-(furan-3-carbonyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 55793659 |
| Molecular Formula | C19H22FN3O4 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 1-(2-ethoxy-4-fluorophenyl)-3-[1-(furan-3-carbonyl)piperidin-4-yl]urea |
| SMILES | CCOc1cc(F)ccc1NC(=O)NC1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C19H22FN3O4/c1-2-27-17-11-14(20)3-4-16(17)22-19(25)21-15-5-8-23(9-6-15)18(24)13-7-10-26-12-13/h3-4,7,10-12,15H,2,5-6,8-9H2,1H3,(H2,21,22,25) |
| InChIKey | JSWZSTZXSKBHOU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |