C22H26N2O5 — CID 38022224
4-(4-ethoxyphenyl)-N-[1-(furan-3-carbonyl)piperidin-4-yl]-4-oxobutanamide (PubChem CID 38022224) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 4-(4-ethoxyphenyl)-N-[1-(furan-3-carbonyl)piperidin-4-yl]-4-oxobutanamide.
| Compound Name | 4-(4-ethoxyphenyl)-N-[1-(furan-3-carbonyl)piperidin-4-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 38022224 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 4-(4-ethoxyphenyl)-N-[1-(furan-3-carbonyl)piperidin-4-yl]-4-oxobutanamide |
| SMILES | CCOc1ccc(C(=O)CCC(=O)NC2CCN(C(=O)c3ccoc3)CC2)cc1 |
| InChI | InChI=1S/C22H26N2O5/c1-2-29-19-5-3-16(4-6-19)20(25)7-8-21(26)23-18-9-12-24(13-10-18)22(27)17-11-14-28-15-17/h3-6,11,14-15,18H,2,7-10,12-13H2,1H3,(H,23,26) |
| InChIKey | DGRJNSPAMWIOQW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |