C14H19FN2O3 — CID 94148395
(2S)-N-(2-ethoxy-4-fluorophenyl)-2-methylmorpholine-4-carboxamide (PubChem CID 94148395) has the molecular formula C14H19FN2O3 and a molecular weight of 282.32 g/mol. Its IUPAC name is (2S)-N-(2-ethoxy-4-fluorophenyl)-2-methylmorpholine-4-carboxamide.
| Compound Name | (2S)-N-(2-ethoxy-4-fluorophenyl)-2-methylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 94148395 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (2S)-N-(2-ethoxy-4-fluorophenyl)-2-methylmorpholine-4-carboxamide |
| SMILES | CCOc1cc(F)ccc1NC(=O)N1CCO[C@@H](C)C1 |
| InChI | InChI=1S/C14H19FN2O3/c1-3-19-13-8-11(15)4-5-12(13)16-14(18)17-6-7-20-10(2)9-17/h4-5,8,10H,3,6-7,9H2,1-2H3,(H,16,18)/t10-/m0/s1 |
| InChIKey | KSNYEIRGDXVBQP-JTQLQIEISA-N |
| XLogP | 2.48 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |