C11H14N2O2 — CID 62699685
1-cyclopropyl-3-[2-(hydroxymethyl)phenyl]urea (PubChem CID 62699685) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 1-cyclopropyl-3-[2-(hydroxymethyl)phenyl]urea.
| Compound Name | 1-cyclopropyl-3-[2-(hydroxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 62699685 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-cyclopropyl-3-[2-(hydroxymethyl)phenyl]urea |
| SMILES | O=C(Nc1ccccc1CO)NC1CC1 |
| InChI | InChI=1S/C11H14N2O2/c14-7-8-3-1-2-4-10(8)13-11(15)12-9-5-6-9/h1-4,9,14H,5-7H2,(H2,12,13,15) |
| InChIKey | OSLDGSXJFGTILD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |